C16H19NO3 — CID 130211286
but-2-ynyl 3-phenyl-3-(propanoylamino)propanoate (PubChem CID 130211286) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is but-2-ynyl 3-phenyl-3-(propanoylamino)propanoate.
| Compound Name | but-2-ynyl 3-phenyl-3-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 130211286 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | but-2-ynyl 3-phenyl-3-(propanoylamino)propanoate |
| SMILES | CC#CCOC(=O)CC(NC(=O)CC)c1ccccc1 |
| InChI | InChI=1S/C16H19NO3/c1-3-5-11-20-16(19)12-14(17-15(18)4-2)13-9-7-6-8-10-13/h6-10,14H,4,11-12H2,1-2H3,(H,17,18) |
| InChIKey | PGRXVTKGFUYLRK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|