C22H31F6N3O2 — CID 130216577
N-[[1-[2-(pentylamino)acetyl]piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide (PubChem CID 130216577) has the molecular formula C22H31F6N3O2 and a molecular weight of 483.50 g/mol. Its IUPAC name is N-[[1-[2-(pentylamino)acetyl]piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-[[1-[2-(pentylamino)acetyl]piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 130216577 |
| Molecular Formula | C22H31F6N3O2 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-[[1-[2-(pentylamino)acetyl]piperidin-4-yl]methyl]-3,5-bis(trifluoromethyl)cyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCCCCNCC(=O)N1CCC(CNC(=O)C2=CC(C(F)(F)F)=CC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C22H31F6N3O2/c1-2-3-4-7-29-14-19(32)31-8-5-15(6-9-31)13-30-20(33)16-10-17(21(23,24)25)12-18(11-16)22(26,27)28/h10,12,15,18,29H,2-9,11,13-14H2,1H3,(H,30,33) |
| InChIKey | XLBAXYPPTTWAIF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|