C22H30F7N3O2 — CID 130216336
(3E,5E)-4,7,7,7-tetrafluoro-6-methyl-2-methylidene-N-[[1-[2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]ethyl]piperidin-4-yl]methyl]hepta-3,5-dienamide (PubChem CID 130216336) has the molecular formula C22H30F7N3O2 and a molecular weight of 501.49 g/mol. Its IUPAC name is (3E,5E)-4,7,7,7-tetrafluoro-6-methyl-2-methylidene-N-[[1-[2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]ethyl]piperidin-4-yl]methyl]hepta-3,5-dienamide.
| Compound Name | (3E,5E)-4,7,7,7-tetrafluoro-6-methyl-2-methylidene-N-[[1-[2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]ethyl]piperidin-4-yl]methyl]hepta-3,5-dienamide |
|---|---|
| PubChem CID | 130216336 |
| Molecular Formula | C22H30F7N3O2 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (3E,5E)-4,7,7,7-tetrafluoro-6-methyl-2-methylidene-N-[[1-[2-[(3,3,3-trifluoro-2,2-dimethylpropanoyl)amino]ethyl]piperidin-4-yl]methyl]hepta-3,5-dienamide |
| SMILES | C=C(/C=C(F)\C=C(/C)C(F)(F)F)C(=O)NCC1CCN(CCNC(=O)C(C)(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H30F7N3O2/c1-14(11-17(23)12-15(2)21(24,25)26)18(33)31-13-16-5-8-32(9-6-16)10-7-30-19(34)20(3,4)22(27,28)29/h11-12,16H,1,5-10,13H2,2-4H3,(H,30,34)(H,31,33)/b15-12+,17-11+ |
| InChIKey | BVQZAHBLQSDOGM-NUWWJRQUSA-N |
| XLogP | 4.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|