C20H29F3N2O — CID 143384376
N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-3,6-difluorocyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 143384376) has the molecular formula C20H29F3N2O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-3,6-difluorocyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-3,6-difluorocyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 143384376 |
| Molecular Formula | C20H29F3N2O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-3,6-difluorocyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | CC(C)(C)CCN1CC[C@@H](CNC(=O)C2=CC(F)=CCC(F)=C2)[C@@H](F)C1 |
| InChI | InChI=1S/C20H29F3N2O/c1-20(2,3)7-9-25-8-6-14(18(23)13-25)12-24-19(26)15-10-16(21)4-5-17(22)11-15/h4,10-11,14,18H,5-9,12-13H2,1-3H3,(H,24,26)/t14-,18-/m0/s1 |
| InChIKey | ZLTCQQMIFZOITH-KSSFIOAISA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |