C19H26N2 — CID 130216637
(2E,3Z)-2-ethylidene-5-[1-[(3E)-3-methylpenta-1,3-dien-2-yl]piperidin-4-yl]hexa-3,5-dienenitrile (PubChem CID 130216637) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-5-[1-[(3E)-3-methylpenta-1,3-dien-2-yl]piperidin-4-yl]hexa-3,5-dienenitrile.
| Compound Name | (2E,3Z)-2-ethylidene-5-[1-[(3E)-3-methylpenta-1,3-dien-2-yl]piperidin-4-yl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 130216637 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (2E,3Z)-2-ethylidene-5-[1-[(3E)-3-methylpenta-1,3-dien-2-yl]piperidin-4-yl]hexa-3,5-dienenitrile |
| SMILES | C=C(/C=C\C(C#N)=C/C)C1CCN(C(=C)/C(C)=C/C)CC1 |
| InChI | InChI=1S/C19H26N2/c1-6-15(3)17(5)21-12-10-19(11-13-21)16(4)8-9-18(7-2)14-20/h6-9,19H,4-5,10-13H2,1-3H3/b9-8-,15-6+,18-7+ |
| InChIKey | LWBFILUINZQABY-PNOHCUKRSA-N |
| XLogP | 4.76 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|