C31H26FN7O2 — CID 130217058
2-[1-[[6-amino-5-(1,3-dimethylindazole-6-carboximidoyl)pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one (PubChem CID 130217058) has the molecular formula C31H26FN7O2 and a molecular weight of 547.59 g/mol. Its IUPAC name is 2-[1-[[6-amino-5-(1,3-dimethylindazole-6-carboximidoyl)pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one.
| Compound Name | 2-[1-[[6-amino-5-(1,3-dimethylindazole-6-carboximidoyl)pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one |
|---|---|
| PubChem CID | 130217058 |
| Molecular Formula | C31H26FN7O2 |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 2-[1-[[6-amino-5-(1,3-dimethylindazole-6-carboximidoyl)pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one |
| SMILES | [H]/N=C(\c1ccc2c(C)nn(C)c2c1)c1c(N)ncnc1NC(C)c1oc2ccccc2c(=O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C31H26FN7O2/c1-16-21-12-11-19(14-23(21)39(3)38-16)27(33)26-30(34)35-15-36-31(26)37-17(2)29-25(18-7-6-8-20(32)13-18)28(40)22-9-4-5-10-24(22)41-29/h4-15,17,33H,1-3H3,(H3,34,35,36,37)/b33-27+ |
| InChIKey | YIPNUOPWBULUPI-MUGXBBEHSA-N |
| XLogP | 5.76 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|