C29H27F2N5O3 — CID 130216909
2-[1-[[6-amino-5-[(Z,2E)-5-fluoro-2-(2-methoxyethylidene)pent-3-enimidoyl]pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one (PubChem CID 130216909) has the molecular formula C29H27F2N5O3 and a molecular weight of 531.56 g/mol. Its IUPAC name is 2-[1-[[6-amino-5-[(Z,2E)-5-fluoro-2-(2-methoxyethylidene)pent-3-enimidoyl]pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one.
| Compound Name | 2-[1-[[6-amino-5-[(Z,2E)-5-fluoro-2-(2-methoxyethylidene)pent-3-enimidoyl]pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one |
|---|---|
| PubChem CID | 130216909 |
| Molecular Formula | C29H27F2N5O3 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 2-[1-[[6-amino-5-[(Z,2E)-5-fluoro-2-(2-methoxyethylidene)pent-3-enimidoyl]pyrimidin-4-yl]amino]ethyl]-3-(3-fluorophenyl)chromen-4-one |
| SMILES | [H]/N=C(C(\C=C/CF)=C\COC)/c1c(N)ncnc1NC(C)c1oc2ccccc2c(=O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C29H27F2N5O3/c1-17(36-29-24(28(33)34-16-35-29)25(32)18(8-6-13-30)12-14-38-2)27-23(19-7-5-9-20(31)15-19)26(37)21-10-3-4-11-22(21)39-27/h3-12,15-17,32H,13-14H2,1-2H3,(H3,33,34,35,36)/b8-6-,18-12+,32-25+ |
| InChIKey | CMTYONJCTVHRNK-GLLFVHSESA-N |
| XLogP | 5.61 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|