C27H25F2N5O3 — CID 123459249
2-[1-[(5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-fluoro-3-(4-fluorophenyl)chromen-4-one (PubChem CID 123459249) has the molecular formula C27H25F2N5O3 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-[1-[(5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-fluoro-3-(4-fluorophenyl)chromen-4-one.
| Compound Name | 2-[1-[(5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-fluoro-3-(4-fluorophenyl)chromen-4-one |
|---|---|
| PubChem CID | 123459249 |
| Molecular Formula | C27H25F2N5O3 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-[1-[(5-ethanimidoyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-5-fluoro-3-(4-fluorophenyl)chromen-4-one |
| SMILES | [H]/N=C(\C)c1c(NC(C)c2oc3cccc(F)c3c(=O)c2-c2ccc(F)cc2)ncnc1N1CCOCC1 |
| InChI | InChI=1S/C27H25F2N5O3/c1-15(30)21-26(31-14-32-27(21)34-10-12-36-13-11-34)33-16(2)25-22(17-6-8-18(28)9-7-17)24(35)23-19(29)4-3-5-20(23)37-25/h3-9,14,16,30H,10-13H2,1-2H3,(H,31,32,33)/b30-15+ |
| InChIKey | AKCDKDSBRZBRET-FJEPWZHXSA-N |
| XLogP | 4.93 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|