C26H38O5 — CID 130217320
(6b,10a-dihydroxy-10,11b-dimethyl-3-oxo-2,5,6,6a,7,8,9,10,11,11a-decahydro-1H-benzo[a]fluoren-7-yl) (E)-3,4-dimethylpent-2-enoate (PubChem CID 130217320) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (6b,10a-dihydroxy-10,11b-dimethyl-3-oxo-2,5,6,6a,7,8,9,10,11,11a-decahydro-1H-benzo[a]fluoren-7-yl) (E)-3,4-dimethylpent-2-enoate.
| Compound Name | (6b,10a-dihydroxy-10,11b-dimethyl-3-oxo-2,5,6,6a,7,8,9,10,11,11a-decahydro-1H-benzo[a]fluoren-7-yl) (E)-3,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 130217320 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (6b,10a-dihydroxy-10,11b-dimethyl-3-oxo-2,5,6,6a,7,8,9,10,11,11a-decahydro-1H-benzo[a]fluoren-7-yl) (E)-3,4-dimethylpent-2-enoate |
| SMILES | C/C(=C\C(=O)OC1CCC(C)C2(O)CC3C(CCC4=CC(=O)CCC43C)C12O)C(C)C |
| InChI | InChI=1S/C26H38O5/c1-15(2)16(3)12-23(28)31-22-9-6-17(4)25(29)14-21-20(26(22,25)30)8-7-18-13-19(27)10-11-24(18,21)5/h12-13,15,17,20-22,29-30H,6-11,14H2,1-5H3/b16-12+ |
| InChIKey | ANIKODPWKQGACM-FOWTUZBSSA-N |
| XLogP | 4.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|