C11H12FN5O4 — CID 130220779
[4-(3-fluorophenyl)-5-oxotetrazol-1-yl] N-(2-methoxyethyl)carbamate (PubChem CID 130220779) has the molecular formula C11H12FN5O4 and a molecular weight of 297.25 g/mol. Its IUPAC name is [4-(3-fluorophenyl)-5-oxotetrazol-1-yl] N-(2-methoxyethyl)carbamate.
| Compound Name | [4-(3-fluorophenyl)-5-oxotetrazol-1-yl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 130220779 |
| Molecular Formula | C11H12FN5O4 |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [4-(3-fluorophenyl)-5-oxotetrazol-1-yl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)On1nnn(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C11H12FN5O4/c1-20-6-5-13-10(18)21-17-11(19)16(14-15-17)9-4-2-3-8(12)7-9/h2-4,7H,5-6H2,1H3,(H,13,18) |
| InChIKey | WSRCQIRFMJTKJM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|