C9H8FN5O2 — CID 130242142
4-(3-fluorophenyl)-N-methyl-5-oxotetrazole-1-carboxamide (PubChem CID 130242142) has the molecular formula C9H8FN5O2 and a molecular weight of 237.19 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-methyl-5-oxotetrazole-1-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-N-methyl-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 130242142 |
| Molecular Formula | C9H8FN5O2 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-(3-fluorophenyl)-N-methyl-5-oxotetrazole-1-carboxamide |
| SMILES | CNC(=O)n1nnn(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C9H8FN5O2/c1-11-8(16)15-9(17)14(12-13-15)7-4-2-3-6(10)5-7/h2-5H,1H3,(H,11,16) |
| InChIKey | CIAREOMXVJTUTJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|