C16H19FN6O3 — CID 86567593
N-ethyl-N-[1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide (PubChem CID 86567593) has the molecular formula C16H19FN6O3 and a molecular weight of 362.37 g/mol. Its IUPAC name is N-ethyl-N-[1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-ethyl-N-[1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 86567593 |
| Molecular Formula | C16H19FN6O3 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-ethyl-N-[1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide |
| SMILES | CCN(C(C)=O)C1CCN(C(=O)n2nnn(-c3cccc(F)c3)c2=O)C1 |
| InChI | InChI=1S/C16H19FN6O3/c1-3-21(11(2)24)14-7-8-20(10-14)15(25)23-16(26)22(18-19-23)13-6-4-5-12(17)9-13/h4-6,9,14H,3,7-8,10H2,1-2H3 |
| InChIKey | ZLYXPHNGEVIHIS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|