C14H14Cl2N6O3 — CID 76806151
N-[1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide (PubChem CID 76806151) has the molecular formula C14H14Cl2N6O3 and a molecular weight of 385.21 g/mol. Its IUPAC name is N-[1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 76806151 |
| Molecular Formula | C14H14Cl2N6O3 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C(=O)n2nnn(-c3c(Cl)cccc3Cl)c2=O)C1 |
| InChI | InChI=1S/C14H14Cl2N6O3/c1-8(23)17-9-5-6-20(7-9)13(24)22-14(25)21(18-19-22)12-10(15)3-2-4-11(12)16/h2-4,9H,5-7H2,1H3,(H,17,23) |
| InChIKey | AQUPVRJEPDJOBH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|