C21H28Cl2N6O4 — CID 58502058
tert-butyl N-[4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]cyclohexyl]carbamate (PubChem CID 58502058) has the molecular formula C21H28Cl2N6O4 and a molecular weight of 499.40 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58502058 |
| Molecular Formula | C21H28Cl2N6O4 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | tert-butyl N-[4-[[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-ethylamino]cyclohexyl]carbamate |
| SMILES | CCN(C(=O)n1nnn(-c2c(Cl)cccc2Cl)c1=O)C1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H28Cl2N6O4/c1-5-27(14-11-9-13(10-12-14)24-18(30)33-21(2,3)4)19(31)29-20(32)28(25-26-29)17-15(22)7-6-8-16(17)23/h6-8,13-14H,5,9-12H2,1-4H3,(H,24,30) |
| InChIKey | RVFYCLFHCVUZOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|