C18H22Cl2N6O3 — CID 58502065
1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 58502065) has the molecular formula C18H22Cl2N6O3 and a molecular weight of 441.32 g/mol. Its IUPAC name is 1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 58502065 |
| Molecular Formula | C18H22Cl2N6O3 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 1-[4-(2,6-dichlorophenyl)-5-oxotetrazole-1-carbonyl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)n2nnn(-c3c(Cl)cccc3Cl)c2=O)C1 |
| InChI | InChI=1S/C18H22Cl2N6O3/c1-3-23(4-2)16(27)12-7-6-10-24(11-12)17(28)26-18(29)25(21-22-26)15-13(19)8-5-9-14(15)20/h5,8-9,12H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | SLKBRFXDLGZAQK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|