C20H25FN6O7 — CID 130221707
[1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl] methyl carbonate (PubChem CID 130221707) has the molecular formula C20H25FN6O7 and a molecular weight of 480.45 g/mol. Its IUPAC name is [1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl] methyl carbonate.
| Compound Name | [1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 130221707 |
| Molecular Formula | C20H25FN6O7 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [1-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl] methyl carbonate |
| SMILES | COC(=O)OC1(NC(=O)OC(C)(C)C)CCN(C(=O)n2nnn(-c3cccc(F)c3)c2=O)CC1 |
| InChI | InChI=1S/C20H25FN6O7/c1-19(2,3)33-15(28)22-20(34-18(31)32-4)8-10-25(11-9-20)16(29)27-17(30)26(23-24-27)14-7-5-6-13(21)12-14/h5-7,12H,8-11H2,1-4H3,(H,22,28) |
| InChIKey | YXHPQJRXLATFHS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|