C17H22FN7O4 — CID 130221706
[4-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]piperazin-1-yl] N,N-diethylcarbamate (PubChem CID 130221706) has the molecular formula C17H22FN7O4 and a molecular weight of 407.41 g/mol. Its IUPAC name is [4-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]piperazin-1-yl] N,N-diethylcarbamate.
| Compound Name | [4-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]piperazin-1-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 130221706 |
| Molecular Formula | C17H22FN7O4 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [4-[4-(3-fluorophenyl)-5-oxotetrazole-1-carbonyl]piperazin-1-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)ON1CCN(C(=O)n2nnn(-c3cccc(F)c3)c2=O)CC1 |
| InChI | InChI=1S/C17H22FN7O4/c1-3-21(4-2)17(28)29-23-10-8-22(9-11-23)15(26)25-16(27)24(19-20-25)14-7-5-6-13(18)12-14/h5-7,12H,3-4,8-11H2,1-2H3 |
| InChIKey | DUOIOCJQXHQTGO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 105.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|