About 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate
3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 130221340) has the molecular formula C19H28FNO4
and a molecular weight of 353.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| PubChem CID | 130221340 |
| Molecular Formula | C19H28FNO4 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H28FNO4/c1-13(2)16(21-18(23)25-19(3,4)5)17(22)24-12-6-7-14-8-10-15(20)11-9-14/h8-11,13,16H,6-7,12H2,1-5H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | QFNTUALLXZLVIB-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
The IUPAC name of 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CID 130221340) is 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
What is the SMILES notation for 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
The canonical SMILES for 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate is CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCCc1ccc(F)cc1.
What is the InChIKey of 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
The InChIKey is QFNTUALLXZLVIB-INIZCTEOSA-N. The full InChI is InChI=1S/C19H28FNO4/c1-13(2)16(21-18(23)25-19(3,4)5)17(22)24-12-6-7-14-8-10-15(20)11-9-14/h8-11,13,16H,6-7,12H2,1-5H3,(H,21,23)/t16-/m0/s1.
What are the key properties of 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate has a molecular weight of 353.43 g/mol, XLogP of 3.85, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)propyl (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate is sourced from PubChem (CID 130221340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).