C16H21NO4 — CID 73294308
5-phenylpentyl N-[(2R,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (PubChem CID 73294308) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-phenylpentyl N-[(2R,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
| Compound Name | 5-phenylpentyl N-[(2R,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
|---|---|
| PubChem CID | 73294308 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 5-phenylpentyl N-[(2R,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| SMILES | C[C@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-12-14(15(18)21-12)17-16(19)20-11-7-3-6-10-13-8-4-2-5-9-13/h2,4-5,8-9,12,14H,3,6-7,10-11H2,1H3,(H,17,19)/t12-,14-/m1/s1 |
| InChIKey | PTVDTLVLQXSSEC-TZMCWYRMSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|