C28H40FNO5 — CID 24971289
[(E,2S)-6-(4-fluorophenyl)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hex-5-en-2-yl] (2S)-2-formamido-4-methylpentanoate (PubChem CID 24971289) has the molecular formula C28H40FNO5 and a molecular weight of 489.63 g/mol. Its IUPAC name is [(E,2S)-6-(4-fluorophenyl)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hex-5-en-2-yl] (2S)-2-formamido-4-methylpentanoate.
| Compound Name | [(E,2S)-6-(4-fluorophenyl)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hex-5-en-2-yl] (2S)-2-formamido-4-methylpentanoate |
|---|---|
| PubChem CID | 24971289 |
| Molecular Formula | C28H40FNO5 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | [(E,2S)-6-(4-fluorophenyl)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]hex-5-en-2-yl] (2S)-2-formamido-4-methylpentanoate |
| SMILES | CCCCCC[C@@H]1C(=O)O[C@H]1C[C@H](CC/C=C/c1ccc(F)cc1)OC(=O)[C@H](CC(C)C)NC=O |
| InChI | InChI=1S/C28H40FNO5/c1-4-5-6-7-12-24-26(35-27(24)32)18-23(34-28(33)25(30-19-31)17-20(2)3)11-9-8-10-21-13-15-22(29)16-14-21/h8,10,13-16,19-20,23-26H,4-7,9,11-12,17-18H2,1-3H3,(H,30,31)/b10-8+/t23-,24-,25-,26-/m0/s1 |
| InChIKey | BUVYSEOZWGZBMQ-GBEQIWDXSA-N |
| XLogP | 5.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|