C17H23NO3 — CID 70688797
N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-7-phenylheptanamide (PubChem CID 70688797) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-7-phenylheptanamide.
| Compound Name | N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-7-phenylheptanamide |
|---|---|
| PubChem CID | 70688797 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]-7-phenylheptanamide |
| SMILES | C[C@@H]1OC(=O)[C@@H]1NC(=O)CCCCCCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-13-16(17(20)21-13)18-15(19)12-8-3-2-5-9-14-10-6-4-7-11-14/h4,6-7,10-11,13,16H,2-3,5,8-9,12H2,1H3,(H,18,19)/t13-,16+/m0/s1 |
| InChIKey | QDEOKQNSXNQTMN-XJKSGUPXSA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|