C13H18F2N2S — CID 130222929
4-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2,6-difluoro-N-methylaniline (PubChem CID 130222929) has the molecular formula C13H18F2N2S and a molecular weight of 272.36 g/mol. Its IUPAC name is 4-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2,6-difluoro-N-methylaniline.
| Compound Name | 4-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2,6-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 130222929 |
| Molecular Formula | C13H18F2N2S |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-[(E)-N-tert-butylsulfanyl-C-methylcarbonimidoyl]-2,6-difluoro-N-methylaniline |
| SMILES | CNc1c(F)cc(/C(C)=N/SC(C)(C)C)cc1F |
| InChI | InChI=1S/C13H18F2N2S/c1-8(17-18-13(2,3)4)9-6-10(14)12(16-5)11(15)7-9/h6-7,16H,1-5H3/b17-8+ |
| InChIKey | QPGDOESHIATWKW-CAOOACKPSA-N |
| XLogP | 4.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|