C13H24N2O — CID 130223869
2,2-dimethylpropyl 2-[(Z)-2-methylbut-1-enyl]iminopropanimidate (PubChem CID 130223869) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[(Z)-2-methylbut-1-enyl]iminopropanimidate.
| Compound Name | 2,2-dimethylpropyl 2-[(Z)-2-methylbut-1-enyl]iminopropanimidate |
|---|---|
| PubChem CID | 130223869 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2,2-dimethylpropyl 2-[(Z)-2-methylbut-1-enyl]iminopropanimidate |
| SMILES | [H]/N=C(OCC(C)(C)C)\C(C)=N\C=C(\C)CC |
| InChI | InChI=1S/C13H24N2O/c1-7-10(2)8-15-11(3)12(14)16-9-13(4,5)6/h8,14H,7,9H2,1-6H3/b10-8-,14-12+,15-11+ |
| InChIKey | LPIYRDNICSBENY-IREQHOOVSA-N |
| XLogP | 3.80 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|