C8H12F3N — CID 143508841
1,1,1-trifluoro-N-[(Z)-2-methylbut-1-enyl]propan-2-imine (PubChem CID 143508841) has the molecular formula C8H12F3N and a molecular weight of 179.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(Z)-2-methylbut-1-enyl]propan-2-imine.
| Compound Name | 1,1,1-trifluoro-N-[(Z)-2-methylbut-1-enyl]propan-2-imine |
|---|---|
| PubChem CID | 143508841 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1,1,1-trifluoro-N-[(Z)-2-methylbut-1-enyl]propan-2-imine |
| SMILES | CC/C(C)=C\N=C(/C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N/c1-4-6(2)5-12-7(3)8(9,10)11/h5H,4H2,1-3H3/b6-5-,12-7+ |
| InChIKey | SXPXCDAOVWSJII-UNKATYBDSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|