C13H24N2 — CID 146529162
N'-[(1E,3E)-2-tert-butyl-4-methylhexa-1,3-dienyl]ethanimidamide (PubChem CID 146529162) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-[(1E,3E)-2-tert-butyl-4-methylhexa-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1E,3E)-2-tert-butyl-4-methylhexa-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 146529162 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-[(1E,3E)-2-tert-butyl-4-methylhexa-1,3-dienyl]ethanimidamide |
| SMILES | CC/C(C)=C/C(=C\N=C(/C)N)C(C)(C)C |
| InChI | InChI=1S/C13H24N2/c1-7-10(2)8-12(13(4,5)6)9-15-11(3)14/h8-9H,7H2,1-6H3,(H2,14,15)/b10-8+,12-9+ |
| InChIKey | SIEJUWVUYFHEGI-AXDLQRQNSA-N |
| XLogP | 3.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|