C10H18S — CID 142132194
(4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene (PubChem CID 142132194) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene.
| Compound Name | (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 142132194 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene |
| SMILES | CC/C(C)=C\C(SC)=C(C)C |
| InChI | InChI=1S/C10H18S/c1-6-9(4)7-10(11-5)8(2)3/h7H,6H2,1-5H3/b9-7- |
| InChIKey | SNEJUNGCUUNNRM-CLFYSBASSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|