About (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene
(4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene (PubChem CID 142132194) has the molecular formula C10H18S
and a molecular weight of 170.32 g/mol. Its IUPAC name is (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene.
Molecular Properties
| Compound Name | (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene |
| PubChem CID | 142132194 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene |
| SMILES | CC/C(C)=C\C(SC)=C(C)C |
| InChI | InChI=1S/C10H18S/c1-6-9(4)7-10(11-5)8(2)3/h7H,6H2,1-5H3/b9-7- |
| InChIKey | SNEJUNGCUUNNRM-CLFYSBASSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene?
The IUPAC name of (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene (CID 142132194) is (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene.
What is the SMILES notation for (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene?
The canonical SMILES for (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene is CC/C(C)=C\C(SC)=C(C)C.
What is the InChIKey of (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene?
The InChIKey is SNEJUNGCUUNNRM-CLFYSBASSA-N. The full InChI is InChI=1S/C10H18S/c1-6-9(4)7-10(11-5)8(2)3/h7H,6H2,1-5H3/b9-7-.
What are the key properties of (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene?
(4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene has a molecular weight of 170.32 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2,5-dimethyl-3-methylsulfanylhepta-2,4-diene is sourced from PubChem (CID 142132194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).