C19H34N4S — CID 139460754
N'-[(1Z,4E,5Z)-9-amino-2-(1-aminoethenyl)-6-methyl-4-(2-sulfanylpentan-3-ylidene)nona-1,5-dienyl]ethanimidamide (PubChem CID 139460754) has the molecular formula C19H34N4S and a molecular weight of 350.58 g/mol. Its IUPAC name is N'-[(1Z,4E,5Z)-9-amino-2-(1-aminoethenyl)-6-methyl-4-(2-sulfanylpentan-3-ylidene)nona-1,5-dienyl]ethanimidamide.
| Compound Name | N'-[(1Z,4E,5Z)-9-amino-2-(1-aminoethenyl)-6-methyl-4-(2-sulfanylpentan-3-ylidene)nona-1,5-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 139460754 |
| Molecular Formula | C19H34N4S |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | N'-[(1Z,4E,5Z)-9-amino-2-(1-aminoethenyl)-6-methyl-4-(2-sulfanylpentan-3-ylidene)nona-1,5-dienyl]ethanimidamide |
| SMILES | C=C(N)/C(=C\N=C(/C)N)CC(/C=C(/C)CCCN)=C(/CC)C(C)S |
| InChI | InChI=1S/C19H34N4S/c1-6-19(15(4)24)17(10-13(2)8-7-9-20)11-18(14(3)21)12-23-16(5)22/h10,12,15,24H,3,6-9,11,20-21H2,1-2,4-5H3,(H2,22,23)/b13-10-,18-12-,19-17- |
| InChIKey | QJMZPYJKMHGEJV-MPIRSEJQSA-N |
| XLogP | 3.82 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|