C18H33N — CID 174352181
(4E,6Z)-6-butan-2-ylidene-2,11-dimethyldodeca-4,11-dien-4-amine (PubChem CID 174352181) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is (4E,6Z)-6-butan-2-ylidene-2,11-dimethyldodeca-4,11-dien-4-amine.
| Compound Name | (4E,6Z)-6-butan-2-ylidene-2,11-dimethyldodeca-4,11-dien-4-amine |
|---|---|
| PubChem CID | 174352181 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (4E,6Z)-6-butan-2-ylidene-2,11-dimethyldodeca-4,11-dien-4-amine |
| SMILES | C=C(C)CCCCC(/C=C(/N)CC(C)C)=C(\C)CC |
| InChI | InChI=1S/C18H33N/c1-7-16(6)17(11-9-8-10-14(2)3)13-18(19)12-15(4)5/h13,15H,2,7-12,19H2,1,3-6H3/b17-16-,18-13+ |
| InChIKey | QHAQTQICBVOHJE-GLQARNANSA-N |
| XLogP | 5.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|