C21H38 — CID 166123890
(6E,7E)-6-(2,2-dimethylpentan-3-ylidene)-2,8,9,9-tetramethyldeca-1,7-diene (PubChem CID 166123890) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is (6E,7E)-6-(2,2-dimethylpentan-3-ylidene)-2,8,9,9-tetramethyldeca-1,7-diene.
| Compound Name | (6E,7E)-6-(2,2-dimethylpentan-3-ylidene)-2,8,9,9-tetramethyldeca-1,7-diene |
|---|---|
| PubChem CID | 166123890 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | (6E,7E)-6-(2,2-dimethylpentan-3-ylidene)-2,8,9,9-tetramethyldeca-1,7-diene |
| SMILES | C=C(C)CCCC(/C=C(\C)C(C)(C)C)=C(/CC)C(C)(C)C |
| InChI | InChI=1S/C21H38/c1-11-19(21(8,9)10)18(14-12-13-16(2)3)15-17(4)20(5,6)7/h15H,2,11-14H2,1,3-10H3/b17-15+,19-18+ |
| InChIKey | DQYPTIFKPVCBFC-CBNHHMLQSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|