About (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine
(E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine (PubChem CID 129167754) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine |
| PubChem CID | 129167754 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine |
| SMILES | C=C(CCC)N/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-7-8-11(3)13-9-10(2)12(4,5)6/h9,13H,3,7-8H2,1-2,4-6H3/b10-9+ |
| InChIKey | WSERDJWUCVNDJE-MDZDMXLPSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine?
The IUPAC name of (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine (CID 129167754) is (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine.
What is the SMILES notation for (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine?
The canonical SMILES for (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine is C=C(CCC)N/C=C(\C)C(C)(C)C.
What is the InChIKey of (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine?
The InChIKey is WSERDJWUCVNDJE-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H23N/c1-7-8-11(3)13-9-10(2)12(4,5)6/h9,13H,3,7-8H2,1-2,4-6H3/b10-9+.
What are the key properties of (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine?
(E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine has a molecular weight of 181.32 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3,3-trimethyl-N-pent-1-en-2-ylbut-1-en-1-amine is sourced from PubChem (CID 129167754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).