C12H21N3O — CID 146420214
N-[(3E,5E)-5-[amino(hydroxy)methylidene]-2-methylhepta-1,3-dien-3-yl]-N'-ethylmethanimidamide (PubChem CID 146420214) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(3E,5E)-5-[amino(hydroxy)methylidene]-2-methylhepta-1,3-dien-3-yl]-N'-ethylmethanimidamide.
| Compound Name | N-[(3E,5E)-5-[amino(hydroxy)methylidene]-2-methylhepta-1,3-dien-3-yl]-N'-ethylmethanimidamide |
|---|---|
| PubChem CID | 146420214 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-[(3E,5E)-5-[amino(hydroxy)methylidene]-2-methylhepta-1,3-dien-3-yl]-N'-ethylmethanimidamide |
| SMILES | C=C(C)/C(=C\C(CC)=C(/N)O)N/C=N/CC |
| InChI | InChI=1S/C12H21N3O/c1-5-10(12(13)16)7-11(9(3)4)15-8-14-6-2/h7-8,16H,3,5-6,13H2,1-2,4H3,(H,14,15)/b11-7+,12-10+ |
| InChIKey | JZGZURQXPGCXBK-CRALUGIISA-N |
| XLogP | 2.22 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|