C8H12F3IN2 — CID 90084225
N'-ethyl-N-[(E)-1,1,1-trifluoro-4-iodo-3-methylbut-2-en-2-yl]methanimidamide (PubChem CID 90084225) has the molecular formula C8H12F3IN2 and a molecular weight of 320.10 g/mol. Its IUPAC name is N'-ethyl-N-[(E)-1,1,1-trifluoro-4-iodo-3-methylbut-2-en-2-yl]methanimidamide.
| Compound Name | N'-ethyl-N-[(E)-1,1,1-trifluoro-4-iodo-3-methylbut-2-en-2-yl]methanimidamide |
|---|---|
| PubChem CID | 90084225 |
| Molecular Formula | C8H12F3IN2 |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | N'-ethyl-N-[(E)-1,1,1-trifluoro-4-iodo-3-methylbut-2-en-2-yl]methanimidamide |
| SMILES | CC/N=C/N/C(=C(\C)CI)C(F)(F)F |
| InChI | InChI=1S/C8H12F3IN2/c1-3-13-5-14-7(6(2)4-12)8(9,10)11/h5H,3-4H2,1-2H3,(H,13,14)/b7-6+ |
| InChIKey | SRFVZYVWFLLXJJ-VOTSOKGWSA-N |
| XLogP | 2.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|