C10H22N2 — CID 144831826
ethane;(E)-4-ethylimino-N,3-dimethylbut-2-en-2-amine (PubChem CID 144831826) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;(E)-4-ethylimino-N,3-dimethylbut-2-en-2-amine.
| Compound Name | ethane;(E)-4-ethylimino-N,3-dimethylbut-2-en-2-amine |
|---|---|
| PubChem CID | 144831826 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;(E)-4-ethylimino-N,3-dimethylbut-2-en-2-amine |
| SMILES | CC.CC/N=C/C(C)=C(\C)NC |
| InChI | InChI=1S/C8H16N2.C2H6/c1-5-10-6-7(2)8(3)9-4;1-2/h6,9H,5H2,1-4H3;1-2H3/b8-7+,10-6+; |
| InChIKey | HVAWZWYITQCJCJ-STJFEJDTSA-N |
| XLogP | 2.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|