C10H18N4 — CID 91410286
3-N,4-N-diethyl-1-N,2-N-dimethylbutane-1,2,3,4-tetraimine (PubChem CID 91410286) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-N,4-N-diethyl-1-N,2-N-dimethylbutane-1,2,3,4-tetraimine.
| Compound Name | 3-N,4-N-diethyl-1-N,2-N-dimethylbutane-1,2,3,4-tetraimine |
|---|---|
| PubChem CID | 91410286 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3-N,4-N-diethyl-1-N,2-N-dimethylbutane-1,2,3,4-tetraimine |
| SMILES | CCN=C(/C=N/CC)C(/C=N/C)=N/C |
| InChI | InChI=1S/C10H18N4/c1-5-13-8-10(14-6-2)9(12-4)7-11-3/h7-8H,5-6H2,1-4H3/b11-7+,12-9+,13-8+,14-10+ |
| InChIKey | JDIRVBQLWFLPFH-OWFGURNWSA-N |
| XLogP | 1.31 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|