C8H13N — CID 130224123
(8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane (PubChem CID 130224123) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane.
| Compound Name | (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane |
|---|---|
| PubChem CID | 130224123 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane |
| SMILES | CN1CC2CC[C@H]3C2C31 |
| InChI | InChI=1S/C8H13N/c1-9-4-5-2-3-6-7(5)8(6)9/h5-8H,2-4H2,1H3/t5?,6-,7?,8?/m0/s1 |
| InChIKey | RDPVUZMOVZHRHV-GGRBJAFOSA-N |
| XLogP | 0.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |