About (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane
(8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane (PubChem CID 130224123) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane.
Molecular Properties
| Compound Name | (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane |
| PubChem CID | 130224123 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane |
| SMILES | CN1CC2CC[C@H]3C2C31 |
| InChI | InChI=1S/C8H13N/c1-9-4-5-2-3-6-7(5)8(6)9/h5-8H,2-4H2,1H3/t5?,6-,7?,8?/m0/s1 |
| InChIKey | RDPVUZMOVZHRHV-GGRBJAFOSA-N |
| XLogP | 0.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane?
The IUPAC name of (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane (CID 130224123) is (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane.
What is the SMILES notation for (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane?
The canonical SMILES for (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane is CN1CC2CC[C@H]3C2C31.
What is the InChIKey of (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane?
The InChIKey is RDPVUZMOVZHRHV-GGRBJAFOSA-N. The full InChI is InChI=1S/C8H13N/c1-9-4-5-2-3-6-7(5)8(6)9/h5-8H,2-4H2,1H3/t5?,6-,7?,8?/m0/s1.
What are the key properties of (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane?
(8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane has a molecular weight of 123.20 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-3-methyl-3-azatricyclo[3.3.0.02,8]octane is sourced from PubChem (CID 130224123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).