C8H17NSi — CID 174102898
dimethyl-[(1R,6S)-2-methyl-2-azabicyclo[2.2.0]hexan-6-yl]silane (PubChem CID 174102898) has the molecular formula C8H17NSi and a molecular weight of 155.32 g/mol. Its IUPAC name is dimethyl-[(1R,6S)-2-methyl-2-azabicyclo[2.2.0]hexan-6-yl]silane.
| Compound Name | dimethyl-[(1R,6S)-2-methyl-2-azabicyclo[2.2.0]hexan-6-yl]silane |
|---|---|
| PubChem CID | 174102898 |
| Molecular Formula | C8H17NSi |
| Molecular Weight | 155.32 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | dimethyl-[(1R,6S)-2-methyl-2-azabicyclo[2.2.0]hexan-6-yl]silane |
| SMILES | CN1CC2C[C@H]([SiH](C)C)[C@@H]21 |
| InChI | InChI=1S/C8H17NSi/c1-9-5-6-4-7(8(6)9)10(2)3/h6-8,10H,4-5H2,1-3H3/t6?,7-,8+/m0/s1 |
| InChIKey | QRIYSIAHDKYMEF-ZHFSPANRSA-N |
| XLogP | 1.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|