C12H20N2 — CID 130224206
(4S)-N,N-diethyl-4,6-dimethyl-4H-azepin-2-amine (PubChem CID 130224206) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (4S)-N,N-diethyl-4,6-dimethyl-4H-azepin-2-amine.
| Compound Name | (4S)-N,N-diethyl-4,6-dimethyl-4H-azepin-2-amine |
|---|---|
| PubChem CID | 130224206 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (4S)-N,N-diethyl-4,6-dimethyl-4H-azepin-2-amine |
| SMILES | CCN(CC)C1=C[C@@H](C)C=C(C)C=N1 |
| InChI | InChI=1S/C12H20N2/c1-5-14(6-2)12-8-10(3)7-11(4)9-13-12/h7-10H,5-6H2,1-4H3/t10-/m0/s1 |
| InChIKey | NLPRMIFSQGUTSO-JTQLQIEISA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |