C12H23N — CID 130224564
(5S,8S)-5-ethyl-6,8-dimethyl-6-azaspiro[3.5]nonane (PubChem CID 130224564) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (5S,8S)-5-ethyl-6,8-dimethyl-6-azaspiro[3.5]nonane.
| Compound Name | (5S,8S)-5-ethyl-6,8-dimethyl-6-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 130224564 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (5S,8S)-5-ethyl-6,8-dimethyl-6-azaspiro[3.5]nonane |
| SMILES | CC[C@@H]1N(C)C[C@@H](C)CC12CCC2 |
| InChI | InChI=1S/C12H23N/c1-4-11-12(6-5-7-12)8-10(2)9-13(11)3/h10-11H,4-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | AMAWEECVZOZBBM-QWRGUYRKSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |