C20H20ClNO5 — CID 130227648
2-(5-chloro-2-nitrophenyl)-2-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propanoic acid (PubChem CID 130227648) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-(5-chloro-2-nitrophenyl)-2-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propanoic acid.
| Compound Name | 2-(5-chloro-2-nitrophenyl)-2-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propanoic acid |
|---|---|
| PubChem CID | 130227648 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-(5-chloro-2-nitrophenyl)-2-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propanoic acid |
| SMILES | CC1(C)CCc2cc(C(C)(C(=O)O)c3cc(Cl)ccc3[N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C20H20ClNO5/c1-19(2)9-8-12-10-13(4-7-17(12)27-19)20(3,18(23)24)15-11-14(21)5-6-16(15)22(25)26/h4-7,10-11H,8-9H2,1-3H3,(H,23,24) |
| InChIKey | ACKLEODBXHABOO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|