C33H48N3O8P — CID 130229826
3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[(2-pyridin-3-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid (PubChem CID 130229826) has the molecular formula C33H48N3O8P and a molecular weight of 645.73 g/mol. Its IUPAC name is 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[(2-pyridin-3-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid.
| Compound Name | 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[(2-pyridin-3-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid |
|---|---|
| PubChem CID | 130229826 |
| Molecular Formula | C33H48N3O8P |
| Molecular Weight | 645.73 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-4-oxo-1-[(2-pyridin-3-ylphenyl)methyl]-1,4λ5-azaphosphinane-3-carboxylic acid |
| SMILES | CCOP1(=O)CCN(Cc2ccccc2-c2cccnc2)CC1(CCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C33H48N3O8P/c1-8-42-45(41)21-20-35(23-26-14-9-10-16-27(26)25-15-13-18-34-22-25)24-33(45,28(37)38)17-11-12-19-36(29(39)43-31(2,3)4)30(40)44-32(5,6)7/h9-10,13-16,18,22H,8,11-12,17,19-21,23-24H2,1-7H3,(H,37,38) |
| InChIKey | ZHLLNJMRZPUZNC-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 135.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.73 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|