C32H53N2O9P — CID 140836392
tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[(2-hydroxyphenyl)methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate (PubChem CID 140836392) has the molecular formula C32H53N2O9P and a molecular weight of 640.76 g/mol. Its IUPAC name is tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[(2-hydroxyphenyl)methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate.
| Compound Name | tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[(2-hydroxyphenyl)methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate |
|---|---|
| PubChem CID | 140836392 |
| Molecular Formula | C32H53N2O9P |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | tert-butyl 3-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]-4-ethoxy-1-[(2-hydroxyphenyl)methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylate |
| SMILES | CCOP1(=O)CCN(Cc2ccccc2O)CC1(CCCCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H53N2O9P/c1-11-40-44(39)21-20-33(22-24-16-12-13-17-25(24)35)23-32(44,26(36)41-29(2,3)4)18-14-15-19-34(27(37)42-30(5,6)7)28(38)43-31(8,9)10/h12-13,16-17,35H,11,14-15,18-23H2,1-10H3 |
| InChIKey | WWTFWDGYNLDIAE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|