C20H29N4O4P — CID 137441696
3-(4-aminobutyl)-4-hydroxy-1-[[2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid (PubChem CID 137441696) has the molecular formula C20H29N4O4P and a molecular weight of 420.45 g/mol. Its IUPAC name is 3-(4-aminobutyl)-4-hydroxy-1-[[2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-4-hydroxy-1-[[2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
|---|---|
| PubChem CID | 137441696 |
| Molecular Formula | C20H29N4O4P |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-(4-aminobutyl)-4-hydroxy-1-[[2-(3-methylimidazol-4-yl)phenyl]methyl]-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
| SMILES | Cn1cncc1-c1ccccc1CN1CCP(=O)(O)C(CCCCN)(C(=O)O)C1 |
| InChI | InChI=1S/C20H29N4O4P/c1-23-15-22-12-18(23)17-7-3-2-6-16(17)13-24-10-11-29(27,28)20(14-24,19(25)26)8-4-5-9-21/h2-3,6-7,12,15H,4-5,8-11,13-14,21H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | OFRSNKUMYDKANV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|