C22H42N6O5S — CID 130234735
N-[2-[2-[2-[2-(4-ethyltriazolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide (PubChem CID 130234735) has the molecular formula C22H42N6O5S and a molecular weight of 502.68 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4-ethyltriazolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide.
| Compound Name | N-[2-[2-[2-[2-(4-ethyltriazolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 130234735 |
| Molecular Formula | C22H42N6O5S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | N-[2-[2-[2-[2-(4-ethyltriazolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
| SMILES | CCC1CN(CCOCCOCCOCCNC(=O)CCCC[C@@H]2SCC3NC(=O)NC32)NN1 |
| InChI | InChI=1S/C22H42N6O5S/c1-2-17-15-28(27-26-17)8-10-32-12-14-33-13-11-31-9-7-23-20(29)6-4-3-5-19-21-18(16-34-19)24-22(30)25-21/h17-19,21,26-27H,2-16H2,1H3,(H,23,29)(H2,24,25,30)/t17?,18?,19-,21?/m0/s1 |
| InChIKey | LEEVTIPWDKEDIK-FCOWATRHSA-N |
| XLogP | -0.02 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|