C26H50N6O5S — CID 144709782
N-[2-[2-[2-[2-[4-(2-methylpentyl)triazolidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide (PubChem CID 144709782) has the molecular formula C26H50N6O5S and a molecular weight of 558.79 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[4-(2-methylpentyl)triazolidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide.
| Compound Name | N-[2-[2-[2-[2-[4-(2-methylpentyl)triazolidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 144709782 |
| Molecular Formula | C26H50N6O5S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | N-[2-[2-[2-[2-[4-(2-methylpentyl)triazolidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
| SMILES | CCCC(C)CC1CN(CCOCCOCCOCCNC(=O)CCCC[C@@H]2SCC3NC(=O)NC32)NN1 |
| InChI | InChI=1S/C26H50N6O5S/c1-3-6-20(2)17-21-18-32(31-30-21)10-12-36-14-16-37-15-13-35-11-9-27-24(33)8-5-4-7-23-25-22(19-38-23)28-26(34)29-25/h20-23,25,30-31H,3-19H2,1-2H3,(H,27,33)(H2,28,29,34)/t20?,21?,22?,23-,25?/m0/s1 |
| InChIKey | VLLZDDRRXUIXIB-IZJILKLZSA-N |
| XLogP | 1.40 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|