C10H7BrClF5 — CID 130236716
1-(1-bromo-2,2,2-trifluoroethyl)-3-chloro-5-(1,1-difluoroethyl)benzene (PubChem CID 130236716) has the molecular formula C10H7BrClF5 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-(1-bromo-2,2,2-trifluoroethyl)-3-chloro-5-(1,1-difluoroethyl)benzene.
| Compound Name | 1-(1-bromo-2,2,2-trifluoroethyl)-3-chloro-5-(1,1-difluoroethyl)benzene |
|---|---|
| PubChem CID | 130236716 |
| Molecular Formula | C10H7BrClF5 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | 1-(1-bromo-2,2,2-trifluoroethyl)-3-chloro-5-(1,1-difluoroethyl)benzene |
| SMILES | CC(F)(F)c1cc(Cl)cc(C(Br)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7BrClF5/c1-9(13,14)6-2-5(3-7(12)4-6)8(11)10(15,16)17/h2-4,8H,1H3 |
| InChIKey | BHVMVKOISNCUBT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|