C12H18ClN — CID 84782173
2-(3-chloro-5-propan-2-ylphenyl)propan-2-amine (PubChem CID 84782173) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is 2-(3-chloro-5-propan-2-ylphenyl)propan-2-amine.
| Compound Name | 2-(3-chloro-5-propan-2-ylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 84782173 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-(3-chloro-5-propan-2-ylphenyl)propan-2-amine |
| SMILES | CC(C)c1cc(Cl)cc(C(C)(C)N)c1 |
| InChI | InChI=1S/C12H18ClN/c1-8(2)9-5-10(12(3,4)14)7-11(13)6-9/h5-8H,14H2,1-4H3 |
| InChIKey | GUIZDPMRQZJPDH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |