C13H18Cl2F3N — CID 171234961
(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentan-1-amine;hydrochloride (PubChem CID 171234961) has the molecular formula C13H18Cl2F3N and a molecular weight of 316.19 g/mol. Its IUPAC name is (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171234961 |
| Molecular Formula | C13H18Cl2F3N |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentan-1-amine;hydrochloride |
| SMILES | CC(C)CC[C@H](N)c1cc(Cl)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C13H17ClF3N.ClH/c1-8(2)3-4-12(18)9-5-10(13(15,16)17)7-11(14)6-9;/h5-8,12H,3-4,18H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | IMCSZCJCNADFPG-YDALLXLXSA-N |
| XLogP | 5.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |