C9H10Cl2F3NO — CID 171234964
(2R)-2-amino-2-[3-chloro-5-(trifluoromethyl)phenyl]ethanol;hydrochloride (PubChem CID 171234964) has the molecular formula C9H10Cl2F3NO and a molecular weight of 276.09 g/mol. Its IUPAC name is (2R)-2-amino-2-[3-chloro-5-(trifluoromethyl)phenyl]ethanol;hydrochloride.
| Compound Name | (2R)-2-amino-2-[3-chloro-5-(trifluoromethyl)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 171234964 |
| Molecular Formula | C9H10Cl2F3NO |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (2R)-2-amino-2-[3-chloro-5-(trifluoromethyl)phenyl]ethanol;hydrochloride |
| SMILES | Cl.N[C@@H](CO)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9ClF3NO.ClH/c10-7-2-5(8(14)4-15)1-6(3-7)9(11,12)13;/h1-3,8,15H,4,14H2;1H/t8-;/m0./s1 |
| InChIKey | DUUDNDDTCGGUNF-QRPNPIFTSA-N |
| XLogP | 2.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |