C10H10ClF4N — CID 171234941
(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine (PubChem CID 171234941) has the molecular formula C10H10ClF4N and a molecular weight of 255.64 g/mol. Its IUPAC name is (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine.
| Compound Name | (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 171234941 |
| Molecular Formula | C10H10ClF4N |
| Molecular Weight | 255.64 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-fluoropropan-1-amine |
| SMILES | N[C@@H](CCF)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10ClF4N/c11-8-4-6(9(16)1-2-12)3-7(5-8)10(13,14)15/h3-5,9H,1-2,16H2/t9-/m0/s1 |
| InChIKey | NHKSSHBNPRDQGV-VIFPVBQESA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |