C12H15ClF3N — CID 171234933
(1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylbutan-1-amine (PubChem CID 171234933) has the molecular formula C12H15ClF3N and a molecular weight of 265.71 g/mol. Its IUPAC name is (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylbutan-1-amine.
| Compound Name | (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 171234933 |
| Molecular Formula | C12H15ClF3N |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (1S)-1-[3-chloro-5-(trifluoromethyl)phenyl]-3-methylbutan-1-amine |
| SMILES | CC(C)C[C@H](N)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15ClF3N/c1-7(2)3-11(17)8-4-9(12(14,15)16)6-10(13)5-8/h4-7,11H,3,17H2,1-2H3/t11-/m0/s1 |
| InChIKey | DZHXDWWGRCHTTG-NSHDSACASA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |